C8H5N3O4S3 — CID 18707671
2-[[5-(carboxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 18707671) has the molecular formula C8H5N3O4S3 and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-[[5-(carboxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[5-(carboxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 18707671 |
| Molecular Formula | C8H5N3O4S3 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 302.94 |
| IUPAC Name | 2-[[5-(carboxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)Cc1nnc(Sc2ncc(C(=O)O)s2)s1 |
| InChI | InChI=1S/C8H5N3O4S3/c12-5(13)1-4-10-11-8(17-4)18-7-9-2-3(16-7)6(14)15/h2H,1H2,(H,12,13)(H,14,15) |
| InChIKey | YVRKVPSAQGQKEI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|