C15H12ClN5OS3 — CID 18707680
2-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-1,3-thiazolidine-3-carbaldehyde (PubChem CID 18707680) has the molecular formula C15H12ClN5OS3 and a molecular weight of 409.95 g/mol. Its IUPAC name is 2-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-1,3-thiazolidine-3-carbaldehyde.
| Compound Name | 2-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-1,3-thiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 18707680 |
| Molecular Formula | C15H12ClN5OS3 |
| Molecular Weight | 409.95 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]-4-phenyl-1,2,4-triazol-3-yl]-1,3-thiazolidine-3-carbaldehyde |
| SMILES | O=CN1CCSC1c1nnc(Sc2ncc(Cl)s2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H12ClN5OS3/c16-11-8-17-15(24-11)25-14-19-18-12(13-20(9-22)6-7-23-13)21(14)10-4-2-1-3-5-10/h1-5,8-9,13H,6-7H2 |
| InChIKey | MONIRJSQFFUIIO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.95 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|