About 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine
3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 18707729) has the molecular formula C9H13ClN6S2
and a molecular weight of 304.83 g/mol. Its IUPAC name is 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 18707729 |
| Molecular Formula | C9H13ClN6S2 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCn1nnnc1Sc1ncc(Cl)s1 |
| InChI | InChI=1S/C9H13ClN6S2/c1-15(2)4-3-5-16-8(12-13-14-16)18-9-11-6-7(10)17-9/h6H,3-5H2,1-2H3 |
| InChIKey | ZONONRFULSLHJO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine (CID 18707729) is 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCn1nnnc1Sc1ncc(Cl)s1.
What is the InChIKey of 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is ZONONRFULSLHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN6S2/c1-15(2)4-3-5-16-8(12-13-14-16)18-9-11-6-7(10)17-9/h6H,3-5H2,1-2H3.
What are the key properties of 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine?
3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 304.83 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 18707729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).