C11H5F3N4S3 — CID 18707734
5-[2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-4-yl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 18707734) has the molecular formula C11H5F3N4S3 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-[2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-4-yl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-4-yl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 18707734 |
| Molecular Formula | C11H5F3N4S3 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 5-[2-[5-(trifluoromethyl)-2-pyridinyl]-1,3-thiazol-4-yl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3n[nH]c(=S)s3)cs2)nc1 |
| InChI | InChI=1S/C11H5F3N4S3/c12-11(13,14)5-1-2-6(15-3-5)8-16-7(4-20-8)9-17-18-10(19)21-9/h1-4H,(H,18,19) |
| InChIKey | YNVQVZXURBGLQT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|