C7H7ClN4S2 — CID 18707803
5-chloro-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 18707803) has the molecular formula C7H7ClN4S2 and a molecular weight of 246.75 g/mol. Its IUPAC name is 5-chloro-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 5-chloro-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18707803 |
| Molecular Formula | C7H7ClN4S2 |
| Molecular Weight | 246.75 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 5-chloro-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | Cc1nnc(Sc2ncc(Cl)s2)n1C |
| InChI | InChI=1S/C7H7ClN4S2/c1-4-10-11-6(12(4)2)14-7-9-3-5(8)13-7/h3H,1-2H3 |
| InChIKey | QXMFBAFOTMDRHE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|