About 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole
2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole (PubChem CID 18707808) has the molecular formula C12H13N5S2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
| PubChem CID | 18707808 |
| Molecular Formula | C12H13N5S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
| SMILES | CC(C)(C)n1nnnc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13N5S2/c1-12(2,3)17-10(14-15-16-17)19-11-13-8-6-4-5-7-9(8)18-11/h4-7H,1-3H3 |
| InChIKey | RSUUQTIRVBMTCV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole?
The IUPAC name of 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole (CID 18707808) is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole.
What is the SMILES notation for 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole?
The canonical SMILES for 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole is CC(C)(C)n1nnnc1Sc1nc2ccccc2s1.
What is the InChIKey of 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole?
The InChIKey is RSUUQTIRVBMTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5S2/c1-12(2,3)17-10(14-15-16-17)19-11-13-8-6-4-5-7-9(8)18-11/h4-7H,1-3H3.
What are the key properties of 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole?
2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole has a molecular weight of 291.40 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-tert-butyltetrazol-5-yl)sulfanyl-1,3-benzothiazole is sourced from PubChem (CID 18707808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).