C10H9N3O4S3 — CID 18707861
2-[[5-(2-ethoxy-2-oxoethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 18707861) has the molecular formula C10H9N3O4S3 and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[[5-(2-ethoxy-2-oxoethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[5-(2-ethoxy-2-oxoethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 18707861 |
| Molecular Formula | C10H9N3O4S3 |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-[[5-(2-ethoxy-2-oxoethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCOC(=O)Cc1nnc(Sc2ncc(C(=O)O)s2)s1 |
| InChI | InChI=1S/C10H9N3O4S3/c1-2-17-7(14)3-6-12-13-10(19-6)20-9-11-4-5(18-9)8(15)16/h4H,2-3H2,1H3,(H,15,16) |
| InChIKey | RUXRTFSYBVCJCT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|