C16H18N4O2S3 — CID 18707968
2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-methylsulfonyl-1,3-thiazole (PubChem CID 18707968) has the molecular formula C16H18N4O2S3 and a molecular weight of 394.55 g/mol. Its IUPAC name is 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-methylsulfonyl-1,3-thiazole.
| Compound Name | 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-methylsulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 18707968 |
| Molecular Formula | C16H18N4O2S3 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-[(5-tert-butyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-5-methylsulfonyl-1,3-thiazole |
| SMILES | CC(C)(C)c1nnc(Sc2ncc(S(C)(=O)=O)s2)n1-c1ccccc1 |
| InChI | InChI=1S/C16H18N4O2S3/c1-16(2,3)13-18-19-14(20(13)11-8-6-5-7-9-11)24-15-17-10-12(23-15)25(4,21)22/h5-10H,1-4H3 |
| InChIKey | AROPFTJGOPQAIL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|