About 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole
5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole (PubChem CID 18708090) has the molecular formula C8H11N5O2S3
and a molecular weight of 305.41 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole |
| PubChem CID | 18708090 |
| Molecular Formula | C8H11N5O2S3 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole |
| SMILES | CCCn1nnnc1Sc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C8H11N5O2S3/c1-3-4-13-7(10-11-12-13)17-8-9-5-6(16-8)18(2,14)15/h5H,3-4H2,1-2H3 |
| InChIKey | BXSMMTUHVYQQBR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole?
The IUPAC name of 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole (CID 18708090) is 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole.
What is the SMILES notation for 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole?
The canonical SMILES for 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole is CCCn1nnnc1Sc1ncc(S(C)(=O)=O)s1.
What is the InChIKey of 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole?
The InChIKey is BXSMMTUHVYQQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O2S3/c1-3-4-13-7(10-11-12-13)17-8-9-5-6(16-8)18(2,14)15/h5H,3-4H2,1-2H3.
What are the key properties of 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole?
5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole has a molecular weight of 305.41 g/mol, XLogP of 1.09, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2-(1-propyltetrazol-5-yl)sulfanyl-1,3-thiazole is sourced from PubChem (CID 18708090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).