C9H9N3O2S3 — CID 18708166
2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 18708166) has the molecular formula C9H9N3O2S3 and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 18708166 |
| Molecular Formula | C9H9N3O2S3 |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)c1nnc(Sc2ncc(C(=O)O)s2)s1 |
| InChI | InChI=1S/C9H9N3O2S3/c1-4(2)6-11-12-9(16-6)17-8-10-3-5(15-8)7(13)14/h3-4H,1-2H3,(H,13,14) |
| InChIKey | NTHTZLUOASDBDJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|