C7H5N3O3S3 — CID 18708240
2-[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 18708240) has the molecular formula C7H5N3O3S3 and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 18708240 |
| Molecular Formula | C7H5N3O3S3 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | 2-[[5-(hydroxymethyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Sc2nnc(CO)s2)s1 |
| InChI | InChI=1S/C7H5N3O3S3/c11-2-4-9-10-7(15-4)16-6-8-1-3(14-6)5(12)13/h1,11H,2H2,(H,12,13) |
| InChIKey | PFHFFBOZQSELCM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|