About 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 18708332) has the molecular formula C6H6N4S2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| PubChem CID | 18708332 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | Cn1cnnc1Sc1nccs1 |
| InChI | InChI=1S/C6H6N4S2/c1-10-4-8-9-5(10)12-6-7-2-3-11-6/h2-4H,1H3 |
| InChIKey | VOPHYXYWSHKPPT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole?
The IUPAC name of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (CID 18708332) is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
What is the SMILES notation for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole?
The canonical SMILES for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole is Cn1cnnc1Sc1nccs1.
What is the InChIKey of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole?
The InChIKey is VOPHYXYWSHKPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2/c1-10-4-8-9-5(10)12-6-7-2-3-11-6/h2-4H,1H3.
What are the key properties of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole?
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole has a molecular weight of 198.28 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole is sourced from PubChem (CID 18708332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).