C5H3ClN4S2 — CID 18708337
5-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole (PubChem CID 18708337) has the molecular formula C5H3ClN4S2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 5-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole.
| Compound Name | 5-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
|---|---|
| PubChem CID | 18708337 |
| Molecular Formula | C5H3ClN4S2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 5-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3-thiazole |
| SMILES | Clc1cnc(Sc2ncn[nH]2)s1 |
| InChI | InChI=1S/C5H3ClN4S2/c6-3-1-7-5(11-3)12-4-8-2-9-10-4/h1-2H,(H,8,9,10) |
| InChIKey | AGGURADRVGMRJI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|