C6H6N4O2S4 — CID 18708352
5-[(5-methylsulfonyl-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 18708352) has the molecular formula C6H6N4O2S4 and a molecular weight of 294.41 g/mol. Its IUPAC name is 5-[(5-methylsulfonyl-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(5-methylsulfonyl-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18708352 |
| Molecular Formula | C6H6N4O2S4 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 293.94 |
| IUPAC Name | 5-[(5-methylsulfonyl-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CS(=O)(=O)c1cnc(Sc2nnc(N)s2)s1 |
| InChI | InChI=1S/C6H6N4O2S4/c1-16(11,12)3-2-8-5(13-3)15-6-10-9-4(7)14-6/h2H,1H3,(H2,7,9) |
| InChIKey | CFXMTLUGAABAHM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|