C10H14N4S2 — CID 18708390
2-[(5-tert-butyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 18708390) has the molecular formula C10H14N4S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[(5-tert-butyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(5-tert-butyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18708390 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[(5-tert-butyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | Cn1c(Sc2nccs2)nnc1C(C)(C)C |
| InChI | InChI=1S/C10H14N4S2/c1-10(2,3)7-12-13-8(14(7)4)16-9-11-5-6-15-9/h5-6H,1-4H3 |
| InChIKey | XZPHSBUWQQOSHI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|