C17H15N5S3 — CID 18708474
N,N-dimethyl-4-[3-(1,3-thiazol-2-ylsulfanyl)-5-thiophen-2-yl-1,2,4-triazol-4-yl]aniline (PubChem CID 18708474) has the molecular formula C17H15N5S3 and a molecular weight of 385.54 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-(1,3-thiazol-2-ylsulfanyl)-5-thiophen-2-yl-1,2,4-triazol-4-yl]aniline.
| Compound Name | N,N-dimethyl-4-[3-(1,3-thiazol-2-ylsulfanyl)-5-thiophen-2-yl-1,2,4-triazol-4-yl]aniline |
|---|---|
| PubChem CID | 18708474 |
| Molecular Formula | C17H15N5S3 |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N,N-dimethyl-4-[3-(1,3-thiazol-2-ylsulfanyl)-5-thiophen-2-yl-1,2,4-triazol-4-yl]aniline |
| SMILES | CN(C)c1ccc(-n2c(Sc3nccs3)nnc2-c2cccs2)cc1 |
| InChI | InChI=1S/C17H15N5S3/c1-21(2)12-5-7-13(8-6-12)22-15(14-4-3-10-23-14)19-20-16(22)25-17-18-9-11-24-17/h3-11H,1-2H3 |
| InChIKey | JKCOBDSOTCUMGP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|