C7H6N4O2S2 — CID 18708487
2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 18708487) has the molecular formula C7H6N4O2S2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 18708487 |
| Molecular Formula | C7H6N4O2S2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Sc2ncc(C(=O)O)s2)n[nH]1 |
| InChI | InChI=1S/C7H6N4O2S2/c1-3-9-6(11-10-3)15-7-8-2-4(14-7)5(12)13/h2H,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | VCHSTYYRXVFDQG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|