About 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline
4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline (PubChem CID 18708789) has the molecular formula C12H11ClN6S2
and a molecular weight of 338.85 g/mol. Its IUPAC name is 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline |
| PubChem CID | 18708789 |
| Molecular Formula | C12H11ClN6S2 |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-n2nnnc2Sc2ncc(Cl)s2)cc1 |
| InChI | InChI=1S/C12H11ClN6S2/c1-18(2)8-3-5-9(6-4-8)19-11(15-16-17-19)21-12-14-7-10(13)20-12/h3-7H,1-2H3 |
| InChIKey | JTMVDZDFSRHLHI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline?
The IUPAC name of 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline (CID 18708789) is 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline?
The canonical SMILES for 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline is CN(C)c1ccc(-n2nnnc2Sc2ncc(Cl)s2)cc1.
What is the InChIKey of 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline?
The InChIKey is JTMVDZDFSRHLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN6S2/c1-18(2)8-3-5-9(6-4-8)19-11(15-16-17-19)21-12-14-7-10(13)20-12/h3-7H,1-2H3.
What are the key properties of 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline?
4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline has a molecular weight of 338.85 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(5-chloro-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]-N,N-dimethylaniline is sourced from PubChem (CID 18708789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).