C14H16N6O2S3 — CID 18708962
N,N-dimethyl-3-[3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]propan-1-amine (PubChem CID 18708962) has the molecular formula C14H16N6O2S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 18708962 |
| Molecular Formula | C14H16N6O2S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N,N-dimethyl-3-[3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-thiophen-2-yl-1,2,4-triazol-4-yl]propan-1-amine |
| SMILES | CN(C)CCCn1c(Sc2ncc([N+](=O)[O-])s2)nnc1-c1cccs1 |
| InChI | InChI=1S/C14H16N6O2S3/c1-18(2)6-4-7-19-12(10-5-3-8-23-10)16-17-13(19)25-14-15-9-11(24-14)20(21)22/h3,5,8-9H,4,6-7H2,1-2H3 |
| InChIKey | KKCVNUZAIAWJHU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|