About 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid (PubChem CID 18709184) has the molecular formula C11H15N5O4S3
and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 18709184 |
| Molecular Formula | C11H15N5O4S3 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CS(=O)(=O)CCCCCn1nnnc1Sc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C11H15N5O4S3/c1-23(19,20)6-4-2-3-5-16-10(13-14-15-16)22-11-12-7-8(21-11)9(17)18/h7H,2-6H2,1H3,(H,17,18) |
| InChIKey | KGRLXEQNRLZWNN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid (CID 18709184) is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid is CS(=O)(=O)CCCCCn1nnnc1Sc1ncc(C(=O)O)s1.
What is the InChIKey of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is KGRLXEQNRLZWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O4S3/c1-23(19,20)6-4-2-3-5-16-10(13-14-15-16)22-11-12-7-8(21-11)9(17)18/h7H,2-6H2,1H3,(H,17,18).
What are the key properties of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid?
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 377.47 g/mol, XLogP of 1.19, 9 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 18709184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).