About 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole
4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole (PubChem CID 18709225) has the molecular formula C10H6ClN3S3
and a molecular weight of 299.83 g/mol. Its IUPAC name is 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole |
| PubChem CID | 18709225 |
| Molecular Formula | C10H6ClN3S3 |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole |
| SMILES | Cc1nnc(Sc2nc3c(Cl)cccc3s2)s1 |
| InChI | InChI=1S/C10H6ClN3S3/c1-5-13-14-10(15-5)17-9-12-8-6(11)3-2-4-7(8)16-9/h2-4H,1H3 |
| InChIKey | IHUVTQOJRHRCNR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The IUPAC name of 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole (CID 18709225) is 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole.
What is the SMILES notation for 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The canonical SMILES for 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole is Cc1nnc(Sc2nc3c(Cl)cccc3s2)s1.
What is the InChIKey of 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The InChIKey is IHUVTQOJRHRCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClN3S3/c1-5-13-14-10(15-5)17-9-12-8-6(11)3-2-4-7(8)16-9/h2-4H,1H3.
What are the key properties of 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole?
4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole has a molecular weight of 299.83 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-1,3-benzothiazole is sourced from PubChem (CID 18709225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).