About 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid
4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid (PubChem CID 18709713) has the molecular formula C23H21NO3
and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| PubChem CID | 18709713 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| SMILES | CCc1ccc(CC)c2oc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)cc12 |
| InChI | InChI=1S/C23H21NO3/c1-3-14-5-6-15(4-2)22-18(14)13-21(27-22)20-12-11-19(24-20)16-7-9-17(10-8-16)23(25)26/h5-13,24H,3-4H2,1-2H3,(H,25,26) |
| InChIKey | FBRWQALVDGIDOG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The IUPAC name of 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid (CID 18709713) is 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid is CCc1ccc(CC)c2oc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)cc12.
What is the InChIKey of 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The InChIKey is FBRWQALVDGIDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO3/c1-3-14-5-6-15(4-2)22-18(14)13-21(27-22)20-12-11-19(24-20)16-7-9-17(10-8-16)23(25)26/h5-13,24H,3-4H2,1-2H3,(H,25,26).
What are the key properties of 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid?
4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid has a molecular weight of 359.43 g/mol, XLogP of 5.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4,7-diethyl-1-benzofuran-2-yl)-1H-pyrrol-2-yl]benzoic acid is sourced from PubChem (CID 18709713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).