About CID 18709898
CID 18709898 (PubChem CID 18709898) has the molecular formula C16H27O4Si2
and a molecular weight of 339.56 g/mol.
Molecular Properties
| Compound Name | CID 18709898 |
| PubChem CID | 18709898 |
| Molecular Formula | C16H27O4Si2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | — |
| SMILES | C=[Si]OC(C)C/C=C/C=C/C(O[Si]C)C(C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H27O4Si2/c1-12(2)18-16(17)14(4)15(20-22-6)11-9-7-8-10-13(3)19-21-5/h7-9,11-15H,5,10H2,1-4,6H3/b8-7+,11-9+ |
| InChIKey | JPMSDUDROLYRHV-MFDVASPDSA-N |
| XLogP | 2.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 18709898 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18709898?
The IUPAC name of CID 18709898 (CID 18709898) is not available.
What is the SMILES notation for CID 18709898?
The canonical SMILES for CID 18709898 is C=[Si]OC(C)C/C=C/C=C/C(O[Si]C)C(C)C(=O)OC(C)C.
What is the InChIKey of CID 18709898?
The InChIKey is JPMSDUDROLYRHV-MFDVASPDSA-N. The full InChI is InChI=1S/C16H27O4Si2/c1-12(2)18-16(17)14(4)15(20-22-6)11-9-7-8-10-13(3)19-21-5/h7-9,11-15H,5,10H2,1-4,6H3/b8-7+,11-9+.
What are the key properties of CID 18709898?
CID 18709898 has a molecular weight of 339.56 g/mol, XLogP of 2.59, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18709898 is sourced from PubChem (CID 18709898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).