C10H22N2O2S — CID 18710131
3,6-di(propan-2-yl)-1,2,7-thiadiazepane 1,1-dioxide (PubChem CID 18710131) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 3,6-di(propan-2-yl)-1,2,7-thiadiazepane 1,1-dioxide.
| Compound Name | 3,6-di(propan-2-yl)-1,2,7-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 18710131 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3,6-di(propan-2-yl)-1,2,7-thiadiazepane 1,1-dioxide |
| SMILES | CC(C)C1CCC(C(C)C)NS(=O)(=O)N1 |
| InChI | InChI=1S/C10H22N2O2S/c1-7(2)9-5-6-10(8(3)4)12-15(13,14)11-9/h7-12H,5-6H2,1-4H3 |
| InChIKey | GHFKINYFLSMSMG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |