C14H22N2O2 — CID 18710358
3,5-dimethyl-7-(1-methylpyrazol-3-yl)octane-2,6-dione (PubChem CID 18710358) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3,5-dimethyl-7-(1-methylpyrazol-3-yl)octane-2,6-dione.
| Compound Name | 3,5-dimethyl-7-(1-methylpyrazol-3-yl)octane-2,6-dione |
|---|---|
| PubChem CID | 18710358 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3,5-dimethyl-7-(1-methylpyrazol-3-yl)octane-2,6-dione |
| SMILES | CC(=O)C(C)CC(C)C(=O)C(C)c1ccn(C)n1 |
| InChI | InChI=1S/C14H22N2O2/c1-9(12(4)17)8-10(2)14(18)11(3)13-6-7-16(5)15-13/h6-7,9-11H,8H2,1-5H3 |
| InChIKey | ZCRRIDPBSXXPCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |