C30H6F14N2O6 — CID 18710859
4,5,7-trifluoro-2-methyl-6-[2,3,5,6-tetrafluoro-4-[4,6,7-trifluoro-1,3-dioxo-2-(2,3,4,6-tetrafluoro-5-methylphenyl)isoindol-5-yl]oxyphenoxy]isoindole-1,3-dione (PubChem CID 18710859) has the molecular formula C30H6F14N2O6 and a molecular weight of 756.36 g/mol. Its IUPAC name is 4,5,7-trifluoro-2-methyl-6-[2,3,5,6-tetrafluoro-4-[4,6,7-trifluoro-1,3-dioxo-2-(2,3,4,6-tetrafluoro-5-methylphenyl)isoindol-5-yl]oxyphenoxy]isoindole-1,3-dione.
| Compound Name | 4,5,7-trifluoro-2-methyl-6-[2,3,5,6-tetrafluoro-4-[4,6,7-trifluoro-1,3-dioxo-2-(2,3,4,6-tetrafluoro-5-methylphenyl)isoindol-5-yl]oxyphenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18710859 |
| Molecular Formula | C30H6F14N2O6 |
| Molecular Weight | 756.36 g/mol |
| Exact Mass | 756.00 |
| IUPAC Name | 4,5,7-trifluoro-2-methyl-6-[2,3,5,6-tetrafluoro-4-[4,6,7-trifluoro-1,3-dioxo-2-(2,3,4,6-tetrafluoro-5-methylphenyl)isoindol-5-yl]oxyphenoxy]isoindole-1,3-dione |
| SMILES | Cc1c(F)c(F)c(F)c(N2C(=O)c3c(F)c(F)c(Oc4c(F)c(F)c(Oc5c(F)c(F)c6c(c5F)C(=O)N(C)C6=O)c(F)c4F)c(F)c3C2=O)c1F |
| InChI | InChI=1S/C30H6F14N2O6/c1-3-8(31)14(37)15(38)22(9(3)32)46-29(49)5-7(30(46)50)13(36)24(17(40)11(5)34)52-26-20(43)18(41)25(19(42)21(26)44)51-23-12(35)6-4(10(33)16(23)39)27(47)45(2)28(6)48/h1-2H3 |
| InChIKey | RXGWAVNWSQFCDH-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.36 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|