C56H46O6S — CID 18711028
methyl 4-[4-[6-[10-(6,8-dimethylnaphthalen-2-yl)-2,6-dimethylanthracen-9-yl]-3-methylnaphthalen-2-yl]oxycarbonyl-2-methylphenyl]sulfonyl-3-methylbenzoate (PubChem CID 18711028) has the molecular formula C56H46O6S and a molecular weight of 847.04 g/mol. Its IUPAC name is methyl 4-[4-[6-[10-(6,8-dimethylnaphthalen-2-yl)-2,6-dimethylanthracen-9-yl]-3-methylnaphthalen-2-yl]oxycarbonyl-2-methylphenyl]sulfonyl-3-methylbenzoate.
| Compound Name | methyl 4-[4-[6-[10-(6,8-dimethylnaphthalen-2-yl)-2,6-dimethylanthracen-9-yl]-3-methylnaphthalen-2-yl]oxycarbonyl-2-methylphenyl]sulfonyl-3-methylbenzoate |
|---|---|
| PubChem CID | 18711028 |
| Molecular Formula | C56H46O6S |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.30 |
| IUPAC Name | methyl 4-[4-[6-[10-(6,8-dimethylnaphthalen-2-yl)-2,6-dimethylanthracen-9-yl]-3-methylnaphthalen-2-yl]oxycarbonyl-2-methylphenyl]sulfonyl-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)c2ccc(C(=O)Oc3cc4ccc(-c5c6ccc(C)cc6c(-c6ccc7cc(C)cc(C)c7c6)c6ccc(C)cc56)cc4cc3C)cc2C)c(C)c1 |
| InChI | InChI=1S/C56H46O6S/c1-31-10-18-46-48(23-31)53(45-17-9-32(2)24-49(45)54(46)41-14-12-39-22-33(3)21-34(4)47(39)29-41)40-13-11-38-30-50(35(5)25-44(38)28-40)62-56(58)43-16-20-52(37(7)27-43)63(59,60)51-19-15-42(26-36(51)6)55(57)61-8/h9-30H,1-8H3 |
| InChIKey | KCBYMFQGLYHCDN-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|