About 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane
2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane (PubChem CID 18711308) has the molecular formula C12H21NW-2
and a molecular weight of 363.15 g/mol. Its IUPAC name is 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane |
| PubChem CID | 18711308 |
| Molecular Formula | C12H21NW-2 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane |
| SMILES | C=C1CC(C)[N-]C=C1C.C=[W].[CH2-]CC |
| InChI | InChI=1S/C8H12N.C3H7.CH2.W/c1-6-4-8(3)9-5-7(6)2;1-3-2;;/h5,8H,1,4H2,2-3H3;1,3H2,2H3;1H2;/q2*-1;; |
| InChIKey | BXJOBPZGSOXWNO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane?
The IUPAC name of 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane (CID 18711308) is 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane.
What is the SMILES notation for 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane?
The canonical SMILES for 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane is C=C1CC(C)[N-]C=C1C.C=[W].[CH2-]CC.
What is the InChIKey of 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane?
The InChIKey is BXJOBPZGSOXWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.C3H7.CH2.W/c1-6-4-8(3)9-5-7(6)2;1-3-2;;/h5,8H,1,4H2,2-3H3;1,3H2,2H3;1H2;/q2*-1;;.
What are the key properties of 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane?
2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane has a molecular weight of 363.15 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-methylidene-2,3-dihydropyridin-1-ide;methylidenetungsten;propane is sourced from PubChem (CID 18711308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).