C14H21NO3S — CID 18711322
1-[(4-acetylcyclohexyl)methyl]-3-methylsulfanylpyrrolidine-2,5-dione (PubChem CID 18711322) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-[(4-acetylcyclohexyl)methyl]-3-methylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[(4-acetylcyclohexyl)methyl]-3-methylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18711322 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[(4-acetylcyclohexyl)methyl]-3-methylsulfanylpyrrolidine-2,5-dione |
| SMILES | CSC1CC(=O)N(CC2CCC(C(C)=O)CC2)C1=O |
| InChI | InChI=1S/C14H21NO3S/c1-9(16)11-5-3-10(4-6-11)8-15-13(17)7-12(19-2)14(15)18/h10-12H,3-8H2,1-2H3 |
| InChIKey | QOIQCUHTVPZQQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|