C10H13F9 — CID 18711328
1,1,1,2,2,3,3,4,4-nonafluoro-5,6,6-trimethylheptane (PubChem CID 18711328) has the molecular formula C10H13F9 and a molecular weight of 304.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-5,6,6-trimethylheptane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5,6,6-trimethylheptane |
|---|---|
| PubChem CID | 18711328 |
| Molecular Formula | C10H13F9 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5,6,6-trimethylheptane |
| SMILES | CC(C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F9/c1-5(6(2,3)4)7(11,12)8(13,14)9(15,16)10(17,18)19/h5H,1-4H3 |
| InChIKey | SVBJPKIFMGDXKB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|