C10H12N2O4 — CID 18712222
N-(1-hydroxypropan-2-yl)-3-nitrobenzamide (PubChem CID 18712222) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-3-nitrobenzamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 18712222 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-3-nitrobenzamide |
| SMILES | CC(CO)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O4/c1-7(6-13)11-10(14)8-3-2-4-9(5-8)12(15)16/h2-5,7,13H,6H2,1H3,(H,11,14) |
| InChIKey | JCPBKGCDKKABSH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|