About 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine
4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 18712409) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 18712409 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CCC1=C(CC)CN(C)CC1 |
| InChI | InChI=1S/C10H19N/c1-4-9-6-7-11(3)8-10(9)5-2/h4-8H2,1-3H3 |
| InChIKey | QIIGYIMUUGPPFC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine (CID 18712409) is 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine is CCC1=C(CC)CN(C)CC1.
What is the InChIKey of 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is QIIGYIMUUGPPFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-4-9-6-7-11(3)8-10(9)5-2/h4-8H2,1-3H3.
What are the key properties of 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine?
4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 153.27 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 18712409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).