C11H22N2 — CID 18712740
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)methanimine (PubChem CID 18712740) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)methanimine.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)methanimine |
|---|---|
| PubChem CID | 18712740 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)methanimine |
| SMILES | C=NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C11H22N2/c1-10(2)7-9(12-5)8-11(3,4)13(10)6/h9H,5,7-8H2,1-4,6H3 |
| InChIKey | XPNUYYJDYFVOOE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|