About (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol
(1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol (PubChem CID 18712843) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol |
| PubChem CID | 18712843 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)c1cncc([C@H](O)CO)n1 |
| InChI | InChI=1S/C8H12N2O4/c11-3-7(13)5-1-9-2-6(10-5)8(14)4-12/h1-2,7-8,11-14H,3-4H2/t7-,8-/m1/s1 |
| InChIKey | XHBKWWIFYARGMR-HTQZYQBOSA-N |
| XLogP | -1.47 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol?
The IUPAC name of (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol (CID 18712843) is (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol.
What is the SMILES notation for (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol?
The canonical SMILES for (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol is OC[C@@H](O)c1cncc([C@H](O)CO)n1.
What is the InChIKey of (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol?
The InChIKey is XHBKWWIFYARGMR-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H12N2O4/c11-3-7(13)5-1-9-2-6(10-5)8(14)4-12/h1-2,7-8,11-14H,3-4H2/t7-,8-/m1/s1.
What are the key properties of (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol?
(1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol has a molecular weight of 200.19 g/mol, XLogP of -1.47, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[6-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]ethane-1,2-diol is sourced from PubChem (CID 18712843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).