C10H18BN3O3S — CID 18713298
methyl-[2-[(4-methylimidazol-1-yl)methyl]-1,1-dioxo-1,4-thiazinan-4-yl]borinic acid (PubChem CID 18713298) has the molecular formula C10H18BN3O3S and a molecular weight of 271.15 g/mol. Its IUPAC name is methyl-[2-[(4-methylimidazol-1-yl)methyl]-1,1-dioxo-1,4-thiazinan-4-yl]borinic acid.
| Compound Name | methyl-[2-[(4-methylimidazol-1-yl)methyl]-1,1-dioxo-1,4-thiazinan-4-yl]borinic acid |
|---|---|
| PubChem CID | 18713298 |
| Molecular Formula | C10H18BN3O3S |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl-[2-[(4-methylimidazol-1-yl)methyl]-1,1-dioxo-1,4-thiazinan-4-yl]borinic acid |
| SMILES | CB(O)N1CCS(=O)(=O)C(Cn2cnc(C)c2)C1 |
| InChI | InChI=1S/C10H18BN3O3S/c1-9-5-13(8-12-9)6-10-7-14(11(2)15)3-4-18(10,16)17/h5,8,10,15H,3-4,6-7H2,1-2H3 |
| InChIKey | WLBCCOGULXZOSI-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|