About N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine
N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine (PubChem CID 18713592) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine |
| PubChem CID | 18713592 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine |
| SMILES | CCN(CC)CC1CN(C)CC1C |
| InChI | InChI=1S/C11H24N2/c1-5-13(6-2)9-11-8-12(4)7-10(11)3/h10-11H,5-9H2,1-4H3 |
| InChIKey | MASLBKADCLGUHI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine?
The IUPAC name of N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine (CID 18713592) is N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine.
What is the SMILES notation for N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine?
The canonical SMILES for N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine is CCN(CC)CC1CN(C)CC1C.
What is the InChIKey of N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine?
The InChIKey is MASLBKADCLGUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-5-13(6-2)9-11-8-12(4)7-10(11)3/h10-11H,5-9H2,1-4H3.
What are the key properties of N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine?
N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine has a molecular weight of 184.33 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpyrrolidin-3-yl)methyl]-N-ethylethanamine is sourced from PubChem (CID 18713592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).