C13H12F4N2O2 — CID 18713624
1-methyl-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-one (PubChem CID 18713624) has the molecular formula C13H12F4N2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 1-methyl-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-one.
| Compound Name | 1-methyl-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-one |
|---|---|
| PubChem CID | 18713624 |
| Molecular Formula | C13H12F4N2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-methyl-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]imidazol-2-one |
| SMILES | Cn1ccn(-c2ccc(OCC(F)(F)C(F)F)cc2)c1=O |
| InChI | InChI=1S/C13H12F4N2O2/c1-18-6-7-19(12(18)20)9-2-4-10(5-3-9)21-8-13(16,17)11(14)15/h2-7,11H,8H2,1H3 |
| InChIKey | DLUNUPYROGAZKH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|