About phenyl N-(2-oxopropyl)carbamate
phenyl N-(2-oxopropyl)carbamate (PubChem CID 18713777) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is phenyl N-(2-oxopropyl)carbamate.
Molecular Properties
| Compound Name | phenyl N-(2-oxopropyl)carbamate |
| PubChem CID | 18713777 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | phenyl N-(2-oxopropyl)carbamate |
| SMILES | CC(=O)CNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c1-8(12)7-11-10(13)14-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,11,13) |
| InChIKey | HVJLCLCPTLDOOM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl N-(2-oxopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(2-oxopropyl)carbamate?
The IUPAC name of phenyl N-(2-oxopropyl)carbamate (CID 18713777) is phenyl N-(2-oxopropyl)carbamate.
What is the SMILES notation for phenyl N-(2-oxopropyl)carbamate?
The canonical SMILES for phenyl N-(2-oxopropyl)carbamate is CC(=O)CNC(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-(2-oxopropyl)carbamate?
The InChIKey is HVJLCLCPTLDOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-8(12)7-11-10(13)14-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,11,13).
What are the key properties of phenyl N-(2-oxopropyl)carbamate?
phenyl N-(2-oxopropyl)carbamate has a molecular weight of 193.20 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(2-oxopropyl)carbamate is sourced from PubChem (CID 18713777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).