C13H23N3O2 — CID 18714089
3,7,7,8,9,9-hexamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 18714089) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 3,7,7,8,9,9-hexamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3,7,7,8,9,9-hexamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 18714089 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3,7,7,8,9,9-hexamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)NC2(CC(C)(C)N(C)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C13H23N3O2/c1-11(2)7-13(8-12(3,4)16(11)6)9(17)15(5)10(18)14-13/h7-8H2,1-6H3,(H,14,18) |
| InChIKey | FJOLZTUMBDQIOL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|