About bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+)
bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) (PubChem CID 18714284) has the molecular formula C34H32FeO4P2
and a molecular weight of 622.42 g/mol. Its IUPAC name is bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+).
Molecular Properties
| Compound Name | bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) |
| PubChem CID | 18714284 |
| Molecular Formula | C34H32FeO4P2 |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) |
| SMILES | C1=CC(P(Oc2ccccc2)Oc2ccccc2)[CH-]C1.C1=CC(P(Oc2ccccc2)Oc2ccccc2)[CH-]C1.[Fe+2] |
| InChI | InChI=1S/2C17H16O2P.Fe/c2*1-3-9-15(10-4-1)18-20(17-13-7-8-14-17)19-16-11-5-2-6-12-16;/h2*1-7,9-14,17H,8H2;/q2*-1;+2 |
| InChIKey | CFFHDMDUJRUAMT-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+)?
The IUPAC name of bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) (CID 18714284) is bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+).
What is the SMILES notation for bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+)?
The canonical SMILES for bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) is C1=CC(P(Oc2ccccc2)Oc2ccccc2)[CH-]C1.C1=CC(P(Oc2ccccc2)Oc2ccccc2)[CH-]C1.[Fe+2].
What is the InChIKey of bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+)?
The InChIKey is CFFHDMDUJRUAMT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H16O2P.Fe/c2*1-3-9-15(10-4-1)18-20(17-13-7-8-14-17)19-16-11-5-2-6-12-16;/h2*1-7,9-14,17H,8H2;/q2*-1;+2.
What are the key properties of bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+)?
bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) has a molecular weight of 622.42 g/mol, XLogP of 9.98, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopent-2-en-1-yl(diphenoxy)phosphane);iron(2+) is sourced from PubChem (CID 18714284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).