About 2,3-dihydropyridine-2,6-dicarbaldehyde
2,3-dihydropyridine-2,6-dicarbaldehyde (PubChem CID 18714338) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 2,3-dihydropyridine-2,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 2,3-dihydropyridine-2,6-dicarbaldehyde |
| PubChem CID | 18714338 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 2,3-dihydropyridine-2,6-dicarbaldehyde |
| SMILES | O=CC1=NC(C=O)CC=C1 |
| InChI | InChI=1S/C7H7NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-2,4-5,7H,3H2 |
| InChIKey | GUGVLVLGQPTLQN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydropyridine-2,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyridine-2,6-dicarbaldehyde?
The IUPAC name of 2,3-dihydropyridine-2,6-dicarbaldehyde (CID 18714338) is 2,3-dihydropyridine-2,6-dicarbaldehyde.
What is the SMILES notation for 2,3-dihydropyridine-2,6-dicarbaldehyde?
The canonical SMILES for 2,3-dihydropyridine-2,6-dicarbaldehyde is O=CC1=NC(C=O)CC=C1.
What is the InChIKey of 2,3-dihydropyridine-2,6-dicarbaldehyde?
The InChIKey is GUGVLVLGQPTLQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-2,4-5,7H,3H2.
What are the key properties of 2,3-dihydropyridine-2,6-dicarbaldehyde?
2,3-dihydropyridine-2,6-dicarbaldehyde has a molecular weight of 137.14 g/mol, XLogP of 0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyridine-2,6-dicarbaldehyde is sourced from PubChem (CID 18714338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).