C18H31NO3 — CID 18714358
ethyl 1-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidine-4-carboxylate (PubChem CID 18714358) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is ethyl 1-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18714358 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | ethyl 1-[(1R,2R,5S)-2-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexyl]piperidine-4-carboxylate |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(O)[C@H](N2CCC(C(=O)OCC)CC2)C1 |
| InChI | InChI=1S/C18H31NO3/c1-5-22-17(20)14-7-10-19(11-8-14)16-12-15(13(2)3)6-9-18(16,4)21/h14-16,21H,2,5-12H2,1,3-4H3/t15-,16+,18+/m0/s1 |
| InChIKey | OIWCNGYTLVKJNH-LZLYRXPVSA-N |
| XLogP | 2.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|