About 2,3,4,5-tetramethyloxane
2,3,4,5-tetramethyloxane (PubChem CID 18714557) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2,3,4,5-tetramethyloxane.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethyloxane |
| PubChem CID | 18714557 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,3,4,5-tetramethyloxane |
| SMILES | CC1COC(C)C(C)C1C |
| InChI | InChI=1S/C9H18O/c1-6-5-10-9(4)8(3)7(6)2/h6-9H,5H2,1-4H3 |
| InChIKey | KKZLVDCCWLOEBZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4,5-tetramethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethyloxane?
The IUPAC name of 2,3,4,5-tetramethyloxane (CID 18714557) is 2,3,4,5-tetramethyloxane.
What is the SMILES notation for 2,3,4,5-tetramethyloxane?
The canonical SMILES for 2,3,4,5-tetramethyloxane is CC1COC(C)C(C)C1C.
What is the InChIKey of 2,3,4,5-tetramethyloxane?
The InChIKey is KKZLVDCCWLOEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-6-5-10-9(4)8(3)7(6)2/h6-9H,5H2,1-4H3.
What are the key properties of 2,3,4,5-tetramethyloxane?
2,3,4,5-tetramethyloxane has a molecular weight of 142.24 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethyloxane is sourced from PubChem (CID 18714557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).