C8H16O2 — CID 18714558
2,4,5,6-tetramethyl-1,3-dioxane (PubChem CID 18714558) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 2,4,5,6-tetramethyl-1,3-dioxane.
| Compound Name | 2,4,5,6-tetramethyl-1,3-dioxane |
|---|---|
| PubChem CID | 18714558 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2,4,5,6-tetramethyl-1,3-dioxane |
| SMILES | CC1OC(C)C(C)C(C)O1 |
| InChI | InChI=1S/C8H16O2/c1-5-6(2)9-8(4)10-7(5)3/h5-8H,1-4H3 |
| InChIKey | POKOYHKEEWSKDN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |