C28H16F6N2O6 — CID 18714644
3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methylbenzoic acid (PubChem CID 18714644) has the molecular formula C28H16F6N2O6 and a molecular weight of 590.43 g/mol. Its IUPAC name is 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methylbenzoic acid.
| Compound Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 18714644 |
| Molecular Formula | C28H16F6N2O6 |
| Molecular Weight | 590.43 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(N2C(=O)c3ccc(C(c4ccc5c(c4)C(=O)N(C)C5=O)(C(F)(F)F)C(F)(F)F)cc3C2=O)c1 |
| InChI | InChI=1S/C28H16F6N2O6/c1-12-7-13(25(41)42)9-16(8-12)36-23(39)18-6-4-15(11-20(18)24(36)40)26(27(29,30)31,28(32,33)34)14-3-5-17-19(10-14)22(38)35(2)21(17)37/h3-11H,1-2H3,(H,41,42) |
| InChIKey | NGCBZBBPZZXULA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|