About 3-methylcyclohepta-1,4,6-trien-1-ol
3-methylcyclohepta-1,4,6-trien-1-ol (PubChem CID 18714791) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 3-methylcyclohepta-1,4,6-trien-1-ol.
Molecular Properties
| Compound Name | 3-methylcyclohepta-1,4,6-trien-1-ol |
| PubChem CID | 18714791 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 3-methylcyclohepta-1,4,6-trien-1-ol |
| SMILES | CC1C=CC=CC(O)=C1 |
| InChI | InChI=1S/C8H10O/c1-7-4-2-3-5-8(9)6-7/h2-7,9H,1H3 |
| InChIKey | HQCPPPIQVWWZCH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylcyclohepta-1,4,6-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohepta-1,4,6-trien-1-ol?
The IUPAC name of 3-methylcyclohepta-1,4,6-trien-1-ol (CID 18714791) is 3-methylcyclohepta-1,4,6-trien-1-ol.
What is the SMILES notation for 3-methylcyclohepta-1,4,6-trien-1-ol?
The canonical SMILES for 3-methylcyclohepta-1,4,6-trien-1-ol is CC1C=CC=CC(O)=C1.
What is the InChIKey of 3-methylcyclohepta-1,4,6-trien-1-ol?
The InChIKey is HQCPPPIQVWWZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7-4-2-3-5-8(9)6-7/h2-7,9H,1H3.
What are the key properties of 3-methylcyclohepta-1,4,6-trien-1-ol?
3-methylcyclohepta-1,4,6-trien-1-ol has a molecular weight of 122.17 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohepta-1,4,6-trien-1-ol is sourced from PubChem (CID 18714791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).