C21H26ClN3 — CID 18715257
13-chloro-2-methyl-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-amine (PubChem CID 18715257) has the molecular formula C21H26ClN3 and a molecular weight of 355.91 g/mol. Its IUPAC name is 13-chloro-2-methyl-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-amine.
| Compound Name | 13-chloro-2-methyl-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-amine |
|---|---|
| PubChem CID | 18715257 |
| Molecular Formula | C21H26ClN3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 13-chloro-2-methyl-2-(1-methylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-amine |
| SMILES | CN1CCC(C2(C)c3ccc(Cl)cc3CCc3cc(N)cnc32)CC1 |
| InChI | InChI=1S/C21H26ClN3/c1-21(16-7-9-25(2)10-8-16)19-6-5-17(22)11-14(19)3-4-15-12-18(23)13-24-20(15)21/h5-6,11-13,16H,3-4,7-10,23H2,1-2H3 |
| InChIKey | HWBWCYBRXUOZSH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |