C27H26FN3O — CID 18715265
1-[4-(14-fluoro-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 18715265) has the molecular formula C27H26FN3O and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[4-(14-fluoro-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[4-(14-fluoro-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 18715265 |
| Molecular Formula | C27H26FN3O |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 1-[4-(14-fluoro-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | Cc1cc2c(cc1F)C(=C1CCN(C(=O)Cc3ccncc3)CC1)c1ncccc1CC2 |
| InChI | InChI=1S/C27H26FN3O/c1-18-15-22-5-4-21-3-2-10-30-27(21)26(23(22)17-24(18)28)20-8-13-31(14-9-20)25(32)16-19-6-11-29-12-7-19/h2-3,6-7,10-12,15,17H,4-5,8-9,13-14,16H2,1H3 |
| InChIKey | AGZKSKQRUMLTQX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |