C19H18ClN3O3 — CID 18715679
(3aS,9bR)-2-[(3-nitrophenyl)methyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile;hydrochloride (PubChem CID 18715679) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is (3aS,9bR)-2-[(3-nitrophenyl)methyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile;hydrochloride.
| Compound Name | (3aS,9bR)-2-[(3-nitrophenyl)methyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 18715679 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3aS,9bR)-2-[(3-nitrophenyl)methyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc2c(c1)[C@@H]1CN(Cc3cccc([N+](=O)[O-])c3)C[C@H]1CO2 |
| InChI | InChI=1S/C19H17N3O3.ClH/c20-8-13-4-5-19-17(7-13)18-11-21(10-15(18)12-25-19)9-14-2-1-3-16(6-14)22(23)24;/h1-7,15,18H,9-12H2;1H/t15-,18+;/m0./s1 |
| InChIKey | JFCYSRNSFFFLOJ-QVNYQEOOSA-N |
| XLogP | 3.50 |
| TPSA | 79.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|