C43H74N2O12 — CID 18715868
1-O-[2-[9-(1-methoxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]-2-methylpropyl] 2-O,3-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 5-oxohexane-1,2,3-tricarboxylate (PubChem CID 18715868) has the molecular formula C43H74N2O12 and a molecular weight of 811.07 g/mol. Its IUPAC name is 1-O-[2-[9-(1-methoxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]-2-methylpropyl] 2-O,3-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 5-oxohexane-1,2,3-tricarboxylate.
| Compound Name | 1-O-[2-[9-(1-methoxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]-2-methylpropyl] 2-O,3-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 5-oxohexane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 18715868 |
| Molecular Formula | C43H74N2O12 |
| Molecular Weight | 811.07 g/mol |
| Exact Mass | 810.52 |
| IUPAC Name | 1-O-[2-[9-(1-methoxy-2-methylpropan-2-yl)-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]-2-methylpropyl] 2-O,3-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 5-oxohexane-1,2,3-tricarboxylate |
| SMILES | COCC(C)(C)C1OCC2(CO1)COC(C(C)(C)COC(=O)CC(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(CC(C)=O)C(=O)OC1CC(C)(C)NC(C)(C)C1)OC2 |
| InChI | InChI=1S/C43H74N2O12/c1-27(46)15-30(33(48)56-28-17-39(6,7)44-40(8,9)18-28)31(34(49)57-29-19-41(10,11)45-42(12,13)20-29)16-32(47)51-22-38(4,5)36-54-25-43(26-55-36)23-52-35(53-24-43)37(2,3)21-50-14/h28-31,35-36,44-45H,15-26H2,1-14H3 |
| InChIKey | ZRXBEXCJIHRJGC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.07 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|